Products 2925103-00-8
CAS 2925103-00-8 is the registry number for 3-{7-bromoimidazo[1,2-a]pyridin-3-yl}piperidine-2,6-dione, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
3-(7-bromoimidazo[1,2-a]pyridin-3-yl)piperidine-2,6-dione (CAS 2925103-00-8) is a chemical compound with the molecular formula C12H10BrN3O2 and a molecular weight of 308.13 g/mol. IUPAC name: 3-(7-bromoimidazo[1,2-a]pyridin-3-yl)piperidine-2,6-dione. InChIKey: HWZLMFMPYUEYFY-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O2 |
|---|---|
| Molecular weight | 308.13 g/mol |
| IUPAC name | 3-(7-bromoimidazo[1,2-a]pyridin-3-yl)piperidine-2,6-dione |
| InChIKey | HWZLMFMPYUEYFY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1C2=CN=C3N2C=CC(=C3)Br |
Computed by PubChem (NCBI)