CAS 2930864-30-3 is the registry number for 7-Chloro-2,3-dihydrobenzofuran-4-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2,3-dihydro-1-benzofuran-4-carbaldehyde (CAS 2930864-30-3) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1-benzofuran-4-carbaldehyde. InChIKey: BNPKLFRYORVSER-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1-benzofuran-4-carbaldehyde |
| InChIKey | BNPKLFRYORVSER-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C=CC(=C21)C=O)Cl |
Computed by PubChem (NCBI)