Products 2940857-80-5

CAS 2940857-80-5 is the registry number for Ethyl trans-4-amino-1-methylcyclohexanecarboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-amino-1-methylcyclohexane-1-carboxylate;hydrochloride (CAS 2940857-80-5) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: ethyl 4-amino-1-methylcyclohexane-1-carboxylate;hydrochloride. InChIKey: NFHQFOMQLVEACK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC nameethyl 4-amino-1-methylcyclohexane-1-carboxylate;hydrochloride
InChIKeyNFHQFOMQLVEACK-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCC(CC1)N)C.Cl

Computed by PubChem (NCBI)