CAS 2940945-65-1 appears in our catalog under these names: Benzofuran-6-amine 2,2,2-trifluoroacetate, 97%, benzofuran-6-amine,2,2,2-trifluoroacetic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 25g, 10g, 100mg, 250mg, 500mg, 1g.
1-benzofuran-6-amine;2,2,2-trifluoroacetic acid (CAS 2940945-65-1) is a chemical compound with the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. IUPAC name: 1-benzofuran-6-amine;2,2,2-trifluoroacetic acid. InChIKey: NAHWDFDZHOZQNV-UHFFFAOYSA-N.
| Molecular formula | C10H8F3NO3 |
|---|---|
| Molecular weight | 247.17 g/mol |
| IUPAC name | 1-benzofuran-6-amine;2,2,2-trifluoroacetic acid |
| InChIKey | NAHWDFDZHOZQNV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CO2)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)