Products 2940950-00-3
CAS 2940950-00-3 is the registry number for tert-butyl 1-carbamoyl-9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 1-carbamoyl-9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate (CAS 2940950-00-3) is a chemical compound with the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. IUPAC name: tert-butyl 1-carbamoyl-9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate. InChIKey: MAIKZNSULRCWGA-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O4 |
|---|---|
| Molecular weight | 282.34 g/mol |
| IUPAC name | tert-butyl 1-carbamoyl-9-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate |
| InChIKey | MAIKZNSULRCWGA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2CCCC(C1)(C2=O)C(=O)N |
Computed by PubChem (NCBI)