CAS 53487-52-8 appears in our catalog under these names: (RS)-1-Methyl-2-propynyl-p-toluenesulfonate, p-Toluenesulfonic acid 1-butyn-3-yl ester, 98%, 98%, BUT-3-YN-2-YL 4-METHYLBENZENESULFONATE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 100g.
But-3-yn-2-yl 4-methylbenzenesulfonate (CAS 53487-52-8) is a chemical compound with the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. IUPAC name: but-3-yn-2-yl 4-methylbenzenesulfonate. InChIKey: XWRDBUBKBUYLQI-UHFFFAOYSA-N.
| Molecular formula | C11H12O3S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | but-3-yn-2-yl 4-methylbenzenesulfonate |
| InChIKey | XWRDBUBKBUYLQI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC(C)C#C |
Computed by PubChem (NCBI)