CAS 29547-08-8 appears in our catalog under these names: 5-Methyl-2-nitro-1,1'-biphenyl, 95%, 5-Methyl-2-nitro-1,1'-biphenyl, ≥95%, ≥95%, 5-Methyl-2-nitro-1,1'-biphenyl. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
4-methyl-1-nitro-2-phenylbenzene (CAS 29547-08-8) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 4-methyl-1-nitro-2-phenylbenzene. InChIKey: UHRJSZIQGJRQOZ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 4-methyl-1-nitro-2-phenylbenzene |
| InChIKey | UHRJSZIQGJRQOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])C2=CC=CC=C2 |
Computed by PubChem (NCBI)