Products 295779-81-6
CAS 295779-81-6 appears in our catalog under these names: 4-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 4-Fluoro-5-methoxy-2,3-dihydro-1h-inden-1-one, 98%, 98%, 4-FLUORO-2,3-DIHYDRO-5-METHOXYINDEN-1-ONE, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
4-fluoro-5-methoxy-2,3-dihydroinden-1-one (CAS 295779-81-6) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 4-fluoro-5-methoxy-2,3-dihydroinden-1-one. InChIKey: PHWKZJQHPREIDN-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 4-fluoro-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | PHWKZJQHPREIDN-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)C(=O)CC2)F |
Computed by PubChem (NCBI)