CAS 29681-98-9 appears in our catalog under these names: 1-(4-Fluorophenyl)butane-1,3-dione, 98%, 98%, 1-(4-Fluorophenyl)butane-1,3-dione 98%, (4–Fluorobenzoyl)acetone, 1-(4-Fluorophenyl)-1,3-butanedione, >97.0%(GC), 1-(4-FLUOROPHENYL)-1,3-DIOXOBUTANE, 97%. Offered by: Chemat, Ambeed, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg.
1-(4-fluorophenyl)butane-1,3-dione (CAS 29681-98-9) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 1-(4-fluorophenyl)butane-1,3-dione. InChIKey: GEFZIAWNHFKQDM-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 1-(4-fluorophenyl)butane-1,3-dione |
| InChIKey | GEFZIAWNHFKQDM-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)