Products 29704-38-9
CAS 29704-38-9 appears in our catalog under these names: tert-Butyl 2-(4-nitrophenyl)acetate, 96%, tert-Butyl 2-(4-nitrophenyl)acetate, 95%, 95%, TERT-BUTYL 2-(4-NITROPHENYL)ACETATE, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Tert-butyl 2-(4-nitrophenyl)acetate (CAS 29704-38-9) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: tert-butyl 2-(4-nitrophenyl)acetate. InChIKey: DQXJXWHNSVKMAT-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | tert-butyl 2-(4-nitrophenyl)acetate |
| InChIKey | DQXJXWHNSVKMAT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)