CAS 29771-82-2 is the registry number for Methyl 2-benzylsulfonylacetate, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
Methyl 2-benzylsulfonylacetate (CAS 29771-82-2) is a chemical compound with the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. IUPAC name: methyl 2-benzylsulfonylacetate. InChIKey: MJSXIDAPNNBSKC-UHFFFAOYSA-N.
| Molecular formula | C10H12O4S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | methyl 2-benzylsulfonylacetate |
| InChIKey | MJSXIDAPNNBSKC-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)