CAS 29822-97-7 is the registry number for 6-Methoxy-1-benzofuran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
6-methoxy-1-benzofuran-3-carboxylic acid (CAS 29822-97-7) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1-benzofuran-3-carboxylic acid. InChIKey: HTAWVHCIBYVPFY-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 6-methoxy-1-benzofuran-3-carboxylic acid |
| InChIKey | HTAWVHCIBYVPFY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CO2)C(=O)O |
Computed by PubChem (NCBI)