Products 29822-97-7

CAS 29822-97-7 is the registry number for 6-Methoxy-1-benzofuran-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

6-methoxy-1-benzofuran-3-carboxylic acid (CAS 29822-97-7) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 6-methoxy-1-benzofuran-3-carboxylic acid. InChIKey: HTAWVHCIBYVPFY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8O4
Molecular weight192.17 g/mol
IUPAC name6-methoxy-1-benzofuran-3-carboxylic acid
InChIKeyHTAWVHCIBYVPFY-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C(=CO2)C(=O)O

Computed by PubChem (NCBI)