Products 2990372-68-2
CAS 2990372-68-2 appears in our catalog under these names: (R)-Cyclopropyl(2,5-difluorophenyl)methanamine hydrochloride, 95%, 95%, (R)-Cyclopropyl(2,5-difluorophenyl)methanamine hydrochloride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(R)-cyclopropyl-(2,5-difluorophenyl)methanamine;hydrochloride (CAS 2990372-68-2) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: (R)-cyclopropyl-(2,5-difluorophenyl)methanamine;hydrochloride. InChIKey: XUCFHMAUQRNZJC-HNCPQSOCSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (R)-cyclopropyl-(2,5-difluorophenyl)methanamine;hydrochloride |
| InChIKey | XUCFHMAUQRNZJC-HNCPQSOCSA-N |
| SMILES | C1CC1[C@H](C2=C(C=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)