CAS 29969-56-0 appears in our catalog under these names: Ethyl 2-chloroquinoline-6-carboxylate, 95+%, Ethyl 2–chloroquinoline–6–carboxylate. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Ethyl 2-chloroquinoline-6-carboxylate (CAS 29969-56-0) is a chemical compound with the molecular formula C12H10ClNO2 and a molecular weight of 235.66 g/mol. IUPAC name: ethyl 2-chloroquinoline-6-carboxylate. InChIKey: LDEPURZVGHLAOX-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO2 |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | ethyl 2-chloroquinoline-6-carboxylate |
| InChIKey | LDEPURZVGHLAOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N=C(C=C2)Cl |
Computed by PubChem (NCBI)