CAS 30074-03-4 appears in our catalog under these names: 3-Hydroxy Phenytoin, >95% (HPLC), 5-(3-hydroxyphenyl)-5-phenylhydantoin. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25 mg, 50 mg, 100 mg.
5-(3-hydroxyphenyl)-5-phenylimidazolidine-2,4-dione (CAS 30074-03-4) is a chemical compound with the molecular formula C15H12N2O3 and a molecular weight of 268.27 g/mol. IUPAC name: 5-(3-hydroxyphenyl)-5-phenylimidazolidine-2,4-dione. InChIKey: FSPRLRPJSPWQNC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O3 |
|---|---|
| Molecular weight | 268.27 g/mol |
| IUPAC name | 5-(3-hydroxyphenyl)-5-phenylimidazolidine-2,4-dione |
| InChIKey | FSPRLRPJSPWQNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C(=O)NC(=O)N2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)