Products 30149-94-1
CAS 30149-94-1 is the registry number for 3-(3-(4-Bromo-phenyl)-(1,2,4)oxadiazol-5-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 30149-94-1) is a chemical compound with the molecular formula C11H9BrN2O3 and a molecular weight of 297.10 g/mol. IUPAC name: 3-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: LBFLFJKKZLTGOV-UHFFFAOYSA-N.
| Molecular formula | C11H9BrN2O3 |
|---|---|
| Molecular weight | 297.10 g/mol |
| IUPAC name | 3-[3-(4-bromophenyl)-1,2,4-oxadiazol-5-yl]propanoic acid |
| InChIKey | LBFLFJKKZLTGOV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCC(=O)O)Br |
Computed by PubChem (NCBI)