Products 30212-52-3
CAS 30212-52-3 appears in our catalog under these names: 2,4-Dichloro-6-methylpyrido[3,2-d]pyrimidine, 98%, 98%, 2,4-Dichloro-6-methylpyrido[3,2-d]pyrimidine, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.
2,4-dichloro-6-methylpyrido[3,2-d]pyrimidine (CAS 30212-52-3) is a chemical compound with the molecular formula C8H5Cl2N3 and a molecular weight of 214.05 g/mol. IUPAC name: 2,4-dichloro-6-methylpyrido[3,2-d]pyrimidine. InChIKey: NOZYRUURZZGLKF-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N3 |
|---|---|
| Molecular weight | 214.05 g/mol |
| IUPAC name | 2,4-dichloro-6-methylpyrido[3,2-d]pyrimidine |
| InChIKey | NOZYRUURZZGLKF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)