Products 3029270-16-1
CAS 3029270-16-1 is the registry number for Dimethyl 2,2'-(1,4-phenylenebis(methaneylylidene))bis(3-oxobutanoate), 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Methyl (2E)-2-[[4-[(E)-2-methoxycarbonyl-3-oxobut-1-enyl]phenyl]methylidene]-3-oxobutanoate (CAS 3029270-16-1) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: methyl (2E)-2-[[4-[(E)-2-methoxycarbonyl-3-oxobut-1-enyl]phenyl]methylidene]-3-oxobutanoate. InChIKey: JOKUAUYWWDXSHM-KAVGSWPWSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | methyl (2E)-2-[[4-[(E)-2-methoxycarbonyl-3-oxobut-1-enyl]phenyl]methylidene]-3-oxobutanoate |
| InChIKey | JOKUAUYWWDXSHM-KAVGSWPWSA-N |
| SMILES | CC(=O)/C(=C\C1=CC=C(C=C1)/C=C(/C(=O)OC)\C(=O)C)/C(=O)OC |
Computed by PubChem (NCBI)