Products 3032-11-9
CAS 3032-11-9 is the registry number for Betaine Ethyl Ester Chloride. Offered by: Mikromol. Available pack sizes: 25mg.
(2-ethoxy-2-oxoethyl)-trimethylazanium chloride (CAS 3032-11-9) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2-ethoxy-2-oxoethyl)-trimethylazanium chloride. InChIKey: JFCJMBHZZMQZAI-UHFFFAOYSA-M.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2-ethoxy-2-oxoethyl)-trimethylazanium chloride |
| InChIKey | JFCJMBHZZMQZAI-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Ethanaminium, 2-ethoxy-N,N,N-trimethyl-2-oxo-, chloride, Ethoxycarbonylmethyltrimethylammonium chloride, Betaine Ethyl Ester Chloride, (2-ethoxy-2-oxoethyl)-trimethylazanium;chloride, (Carbethoxymethyl)trimethylammonium chloride, JFCJMBHZZMQZAI-UHFFFAOYSA-M, (2-ethoxy-2-oxo-ethyl)-trimethyl-ammonium, 2-Ethoxy-N,N,N-trimethyl-2-oxoethan-1-aminium chloride