Products 305324-58-7

CAS 305324-58-7 is the registry number for 2-(3-Hydroxynaphthalen-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(3-hydroxynaphthalen-2-yl)acetic acid (CAS 305324-58-7) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 2-(3-hydroxynaphthalen-2-yl)acetic acid. InChIKey: PQFDONBGIMZFEG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10O3
Molecular weight202.21 g/mol
IUPAC name2-(3-hydroxynaphthalen-2-yl)acetic acid
InChIKeyPQFDONBGIMZFEG-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C(=CC2=C1)CC(=O)O)O

Computed by PubChem (NCBI)