CAS 305324-58-7 is the registry number for 2-(3-Hydroxynaphthalen-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(3-hydroxynaphthalen-2-yl)acetic acid (CAS 305324-58-7) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 2-(3-hydroxynaphthalen-2-yl)acetic acid. InChIKey: PQFDONBGIMZFEG-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 2-(3-hydroxynaphthalen-2-yl)acetic acid |
| InChIKey | PQFDONBGIMZFEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)CC(=O)O)O |
Computed by PubChem (NCBI)