Products 30614-77-8
CAS 30614-77-8 appears in our catalog under these names: Diethyl 3，4–Furandicarboxylate, Diethyl 3,4-furandicarboxylate, Diethyl 3,4-furandicarboxylate, 95%, Diethyl furan-3,4-dicarboxylate, 98%, 98%, Diethyl 3,4-furandicarboxylate, min. 95 %, 10 g. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Chemat, Roth. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 100mg, 250mg.
Diethyl furan-3,4-dicarboxylate (CAS 30614-77-8) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: diethyl furan-3,4-dicarboxylate. InChIKey: ZODFWNHYQARJLC-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | diethyl furan-3,4-dicarboxylate |
| InChIKey | ZODFWNHYQARJLC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=COC=C1C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
3,4-Diethyl 3,4-furandicarboxylate, Diethyl 3,4-furandicarboxylate, Diethyl furan-3,4-dicarboxylate, 3,4-diethyl furan-3,4-dicarboxylate, 3,4-Furandicarboxylic acid, 3,4-diethyl ester, furan-3,4-dicarboxylic acid diethyl ester, 5-18-07-00053 (Beilstein Handbook Reference), ZODFWNHYQARJLC-UHFFFAOYSA-