Products 30890-35-8
CAS 30890-35-8 appears in our catalog under these names: 8–Epixanthatin, 8-Epixanthatin, 8-Epixanthatin, 99.61%, 8-Epixanthatin, 99.51%, 99.51%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 10mM/1mL, 1 mg, 10 mg.
(3aR,7S,8aR)-7-methyl-3-methylidene-6-[(E)-3-oxobut-1-enyl]-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one (CAS 30890-35-8) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: (3aR,7S,8aR)-7-methyl-3-methylidene-6-[(E)-3-oxobut-1-enyl]-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one. InChIKey: RBRPTFMVULVGIC-MDKNCZOUSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (3aR,7S,8aR)-7-methyl-3-methylidene-6-[(E)-3-oxobut-1-enyl]-4,7,8,8a-tetrahydro-3aH-cyclohepta[b]furan-2-one |
| InChIKey | RBRPTFMVULVGIC-MDKNCZOUSA-N |
| SMILES | C[C@H]1C[C@@H]2[C@H](CC=C1/C=C/C(=O)C)C(=C)C(=O)O2 |
Computed by PubChem (NCBI)