CAS 3096-81-9 appears in our catalog under these names: 4–Phenoxybenzonitrile, 4-Phenoxybenzonitrile, 96% , 4-Phenoxybenzonitrile, 4-Phenoxybenzonitrile, >98.0%(GC), 4-Phenoxybenzonitrile 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 5g, 2g, 10g, 0,05kg, 0,1kg, 0,25kg, 0,5kg, 1kg.
4-phenoxybenzonitrile (CAS 3096-81-9) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 4-phenoxybenzonitrile. InChIKey: UYHCIOZMFCLUDP-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 4-phenoxybenzonitrile |
| InChIKey | UYHCIOZMFCLUDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)