CAS 309977-94-4 appears in our catalog under these names: (3-Fluoro-2,6-dimethoxyphenyl)boronic acid, 97%, (3-Fluoro-2,6-dimethoxyphenyl)boronic acid, (3-fluoro-2,6-dimethoxyphenyl)boronic acid, ≥95%, ≥95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 100mg.
(3-fluoro-2,6-dimethoxyphenyl)boronic acid (CAS 309977-94-4) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (3-fluoro-2,6-dimethoxyphenyl)boronic acid. InChIKey: FOGFIRLRCNBQNA-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (3-fluoro-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | FOGFIRLRCNBQNA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)F)OC)(O)O |
Computed by PubChem (NCBI)