CAS 312310-61-5 is the registry number for 5-((4-Chloro-3,5-dimethyl-1H-pyrazol-1-yl)methyl)furan-2-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g.
5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid (CAS 312310-61-5) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid. InChIKey: CLZYAKOJMOCPJY-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]furan-2-carboxylic acid |
| InChIKey | CLZYAKOJMOCPJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=C(O2)C(=O)O)C)Cl |
Computed by PubChem (NCBI)