Products 3130-76-5

CAS 3130-76-5 appears in our catalog under these names: 2-((3-carboxypropyl)carbamoyl)benzoic acid, 95%, N-(3-Carboxy-propyl)-phthalamic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(3-carboxypropylcarbamoyl)benzoic acid (CAS 3130-76-5) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 2-(3-carboxypropylcarbamoyl)benzoic acid. InChIKey: LENIZMSGCFPTBO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13NO5
Molecular weight251.23 g/mol
IUPAC name2-(3-carboxypropylcarbamoyl)benzoic acid
InChIKeyLENIZMSGCFPTBO-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NCCCC(=O)O)C(=O)O

Computed by PubChem (NCBI)