CAS 3139-06-8 is the registry number for 1-Methoxy-2,5-dimethyl-4-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-methoxy-2,5-dimethyl-4-nitrobenzene (CAS 3139-06-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 1-methoxy-2,5-dimethyl-4-nitrobenzene. InChIKey: KCPIVGRYBOMWHH-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 1-methoxy-2,5-dimethyl-4-nitrobenzene |
| InChIKey | KCPIVGRYBOMWHH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)