Products 31529-27-8
CAS 31529-27-8 appears in our catalog under these names: 3-(Carboxymethyl)-1H-indole-2-carboxylic acid, 3-(Carboxymethyl)-1H-Indole-2-Carboxylic Acid, 95%, 95%, 3-(Carboxymethyl)-1h-indole-2-carboxylic acid, 95%, 3-(Carboxymethyl)-1H-indole-2-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 25mg, 50mg, 250mg.
3-(carboxymethyl)-1H-indole-2-carboxylic acid (CAS 31529-27-8) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 3-(carboxymethyl)-1H-indole-2-carboxylic acid. InChIKey: CRMJDDJAUJZUDJ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 3-(carboxymethyl)-1H-indole-2-carboxylic acid |
| InChIKey | CRMJDDJAUJZUDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(N2)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(carboxymethyl)-1H-indole-2-carboxylic acid, 2-Carboxy-3-indoleacetic acid, 3-(carboxymethyl)indole-2-carboxylic acid, 1H-Indole-3-acetic acid, 2-carboxy-, 2-carboxyindole-3-acetic acid, 3-Carboxymethyl-1H-indole-2-carboxylic acid, Cambridge id 6772246, TimTec1_003626, Oprea1_354235, CRMJDDJAUJZUDJ-UHFFFAOYSA-N