Products 316155-87-0

CAS 316155-87-0 appears in our catalog under these names: 1,7-Naphthyridine-2-carboxylic acid, 1,7-Naphthyridine-2-carboxylic acid 98%, 1,7-Naphthyridine-2-carboxylic acid, 98%, 98%, 1,7-Naphthyridine-2-carboxylic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.

1,7-naphthyridine-2-carboxylic acid (CAS 316155-87-0) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,7-naphthyridine-2-carboxylic acid. InChIKey: NKZWGRNUQFUDQW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O2
Molecular weight174.16 g/mol
IUPAC name1,7-naphthyridine-2-carboxylic acid
InChIKeyNKZWGRNUQFUDQW-UHFFFAOYSA-N
SMILESC1=CC(=NC2=C1C=CN=C2)C(=O)O

Computed by PubChem (NCBI)