CAS 316810-08-9 is the registry number for 4-Cyano-2-ethoxybenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyano-2-ethoxybenzoic acid (CAS 316810-08-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-cyano-2-ethoxybenzoic acid. InChIKey: HITJHKFIMRWIDL-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-cyano-2-ethoxybenzoic acid |
| InChIKey | HITJHKFIMRWIDL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C#N)C(=O)O |
Computed by PubChem (NCBI)