CAS 3178-75-4 is the registry number for Anthracene-2,3,6,7-tetraol, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Anthracene-2,3,6,7-tetrol (CAS 3178-75-4) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: anthracene-2,3,6,7-tetrol. InChIKey: ONBNQLKJWJFARW-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | anthracene-2,3,6,7-tetrol |
| InChIKey | ONBNQLKJWJFARW-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C(=CC2=CC3=CC(=C(C=C31)O)O)O)O |
Computed by PubChem (NCBI)