Products 821797-33-5
CAS 821797-33-5 is the registry number for 4-[(1E)-2-Nitroethenyl]benzoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-2-nitroethenyl]benzoic acid (CAS 821797-33-5) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 4-[(E)-2-nitroethenyl]benzoic acid. InChIKey: GFQGFOJCOPZGPB-AATRIKPKSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 4-[(E)-2-nitroethenyl]benzoic acid |
| InChIKey | GFQGFOJCOPZGPB-AATRIKPKSA-N |
| SMILES | C1=CC(=CC=C1/C=C/[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)