Products 31952-16-6
CAS 31952-16-6 appears in our catalog under these names: 2,2-Dibenzyl-1,3-propanediol, 99.96%, 2,2-Dibenzylpropane-1,3-diol, 95%, 2,2-Dibenzylpropane-1,3-diol, 98%, 2,2-Dibenzyl-1,3-propanediol >= 97.0 %. Offered by: MedChemExpress, Ambeed, BLDpharm, Fluorochem, Sigma-Aldrich. Available pack sizes: 1 g, 500 mg, 5 g, 250 mg, 10 g, 250mg, 1g, 5g.
2,2-dibenzylpropane-1,3-diol (CAS 31952-16-6) is a chemical compound with the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. IUPAC name: 2,2-dibenzylpropane-1,3-diol. InChIKey: AZLRECYOMFCGTK-UHFFFAOYSA-N.
| Molecular formula | C17H20O2 |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | 2,2-dibenzylpropane-1,3-diol |
| InChIKey | AZLRECYOMFCGTK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(CC2=CC=CC=C2)(CO)CO |
Computed by PubChem (NCBI)