CAS 320-98-9 appears in our catalog under these names: 5-Fluoro-2-nitrobenzoic acid, 98%, 98%, 5-Fluoro-2-nitrobenzoic acid, 98%, 5-Fluoro-2-nitrobenzoic acid 98%, 5–Fluoro–2–nitrobenzoic Acid, 5-Fluoro-2-nitrobenzoic acid. Offered by: Chemat, Thermo Scientific (Acros), Ambeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g.
5-fluoro-2-nitrobenzoic acid (CAS 320-98-9) is a chemical compound with the molecular formula C7H4FNO4 and a molecular weight of 185.11 g/mol. IUPAC name: 5-fluoro-2-nitrobenzoic acid. InChIKey: GHYZIXDKAPMFCS-UHFFFAOYSA-N.
| Molecular formula | C7H4FNO4 |
|---|---|
| Molecular weight | 185.11 g/mol |
| IUPAC name | 5-fluoro-2-nitrobenzoic acid |
| InChIKey | GHYZIXDKAPMFCS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)