CAS 3205-35-4 appears in our catalog under these names: Dimethyl trans–1,2–Cyclohexanedicarboxylate, trans-Dimethyl cyclohexane-1,2-dicarboxylate 96%, trans-Dimethyl cyclohexane-1,2-dicarboxylate, 96%, 96%, rel-Dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g, 100mg, 250mg, 25g.
Trans-dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate (CAS 3205-35-4) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: trans-dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate. InChIKey: AIACXWOETVLBIA-HTQZYQBOSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | trans-dimethyl (1R,2R)-cyclohexane-1,2-dicarboxylate |
| InChIKey | AIACXWOETVLBIA-HTQZYQBOSA-N |
| SMILES | COC(=O)[C@@H]1CCCC[C@H]1C(=O)OC |
Computed by PubChem (NCBI)