Products 32253-75-1

CAS 32253-75-1 is the registry number for 5-Bromo-2-((carboxymethyl)amino)benzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 25g.

Structural formula: {0} (CAS {1})

5-bromo-2-(carboxymethylamino)benzoic acid (CAS 32253-75-1) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: 5-bromo-2-(carboxymethylamino)benzoic acid. InChIKey: NGTZRRAYYJFRDA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8BrNO4
Molecular weight274.07 g/mol
IUPAC name5-bromo-2-(carboxymethylamino)benzoic acid
InChIKeyNGTZRRAYYJFRDA-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)C(=O)O)NCC(=O)O

Computed by PubChem (NCBI)