CAS 32253-75-1 is the registry number for 5-Bromo-2-((carboxymethyl)amino)benzoic acid, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
5-bromo-2-(carboxymethylamino)benzoic acid (CAS 32253-75-1) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: 5-bromo-2-(carboxymethylamino)benzoic acid. InChIKey: NGTZRRAYYJFRDA-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | 5-bromo-2-(carboxymethylamino)benzoic acid |
| InChIKey | NGTZRRAYYJFRDA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)NCC(=O)O |
Computed by PubChem (NCBI)