Products 322725-48-4

CAS 322725-48-4 is the registry number for 3-[3-(2-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid (CAS 322725-48-4) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid. InChIKey: IQXXNMCDSHIYDO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O4
Molecular weight248.23 g/mol
IUPAC name3-[3-(2-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoic acid
InChIKeyIQXXNMCDSHIYDO-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1C2=NOC(=N2)CCC(=O)O

Computed by PubChem (NCBI)