CAS 32327-48-3 is the registry number for 5-Acetamidonaphthalene-1-sulfonamide. Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
N-(5-sulfamoylnaphthalen-1-yl)acetamide (CAS 32327-48-3) is a chemical compound with the molecular formula C12H12N2O3S and a molecular weight of 264.30 g/mol. IUPAC name: N-(5-sulfamoylnaphthalen-1-yl)acetamide. InChIKey: OXGMADUQTHJYOL-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O3S |
|---|---|
| Molecular weight | 264.30 g/mol |
| IUPAC name | N-(5-sulfamoylnaphthalen-1-yl)acetamide |
| InChIKey | OXGMADUQTHJYOL-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC2=C1C=CC=C2S(=O)(=O)N |
Computed by PubChem (NCBI)