CAS 32331-81-0 is the registry number for 2-(4-Hydroxybut-2-yn-1-yl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(4-hydroxybut-2-ynyl)isoindole-1,3-dione (CAS 32331-81-0) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-(4-hydroxybut-2-ynyl)isoindole-1,3-dione. InChIKey: IBNBDAYJRGIYEC-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-(4-hydroxybut-2-ynyl)isoindole-1,3-dione |
| InChIKey | IBNBDAYJRGIYEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC#CCO |
Computed by PubChem (NCBI)