CAS 32620-61-4 appears in our catalog under these names: N-(2-Furylmethyl)maleimide, 95%, 1-(Furan-2-ylmethyl)-1H-pyrrole-2,5-dione, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(furan-2-ylmethyl)pyrrole-2,5-dione (CAS 32620-61-4) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 1-(furan-2-ylmethyl)pyrrole-2,5-dione. InChIKey: LGSUUIGEQAOVIU-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 1-(furan-2-ylmethyl)pyrrole-2,5-dione |
| InChIKey | LGSUUIGEQAOVIU-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)