Products 32702-14-0

CAS 32702-14-0 is the registry number for Ethyl 3-acetyl-2-methyl-4-oxopentanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 3-acetyl-2-methyl-4-oxopentanoate (CAS 32702-14-0) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl 3-acetyl-2-methyl-4-oxopentanoate. InChIKey: GJAKVEZXDGDNIS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC nameethyl 3-acetyl-2-methyl-4-oxopentanoate
InChIKeyGJAKVEZXDGDNIS-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)C(C(=O)C)C(=O)C

Computed by PubChem (NCBI)