CAS 32702-14-0 is the registry number for Ethyl 3-acetyl-2-methyl-4-oxopentanoate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Ethyl 3-acetyl-2-methyl-4-oxopentanoate (CAS 32702-14-0) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl 3-acetyl-2-methyl-4-oxopentanoate. InChIKey: GJAKVEZXDGDNIS-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | ethyl 3-acetyl-2-methyl-4-oxopentanoate |
| InChIKey | GJAKVEZXDGDNIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C(C(=O)C)C(=O)C |
Computed by PubChem (NCBI)