CAS 327051-07-0 appears in our catalog under these names: H–Ala(3–pyridyl)–OMe·2HCl, H-Ala(3-pyridyl)-OMe.2HCl, 98%, 98%, (S)-Methyl 2-amino-3-(pyridin-3-yl)propanoate dihydrochloride, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100mg, 250mg, 1g.
Methyl (2S)-2-amino-3-pyridin-3-ylpropanoate;dihydrochloride (CAS 327051-07-0) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: methyl (2S)-2-amino-3-pyridin-3-ylpropanoate;dihydrochloride. InChIKey: XNSHHLGNMODFNC-JZGIKJSDSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-pyridin-3-ylpropanoate;dihydrochloride |
| InChIKey | XNSHHLGNMODFNC-JZGIKJSDSA-N |
| SMILES | COC(=O)[C@H](CC1=CN=CC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)