CAS 32709-74-3 appears in our catalog under these names: 2,4,6-Trimethylbenzoyl isothiocyanate, 95%, 2,4,6-Trimethylbenzoyl isothiocyanate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2,4,6-trimethylbenzoyl isothiocyanate (CAS 32709-74-3) is a chemical compound with the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. IUPAC name: 2,4,6-trimethylbenzoyl isothiocyanate. InChIKey: HRCDFWAWYGALDR-UHFFFAOYSA-N.
| Molecular formula | C11H11NOS |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 2,4,6-trimethylbenzoyl isothiocyanate |
| InChIKey | HRCDFWAWYGALDR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(=O)N=C=S)C |
Computed by PubChem (NCBI)