CAS 328071-16-5 is the registry number for 5-(2-Amino-4-thiazolyl)-2-hydroxybenzamide. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-(2-amino-1,3-thiazol-4-yl)-2-hydroxybenzamide (CAS 328071-16-5) is a chemical compound with the molecular formula C10H9N3O2S and a molecular weight of 235.26 g/mol. IUPAC name: 5-(2-amino-1,3-thiazol-4-yl)-2-hydroxybenzamide. InChIKey: ICWYTLUIOHVZIR-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 5-(2-amino-1,3-thiazol-4-yl)-2-hydroxybenzamide |
| InChIKey | ICWYTLUIOHVZIR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CSC(=N2)N)C(=O)N)O |
Computed by PubChem (NCBI)