CAS 32816-99-2 is the registry number for 4-Phenylmorpholine-2,3-dione, 95+%. Offered by: AmBeed. Available pack sizes: 25g.
4-phenylmorpholine-2,3-dione (CAS 32816-99-2) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 4-phenylmorpholine-2,3-dione. InChIKey: GFYYMNWPWAZLOM-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 4-phenylmorpholine-2,3-dione |
| InChIKey | GFYYMNWPWAZLOM-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C(=O)N1C2=CC=CC=C2 |
Computed by PubChem (NCBI)