Products 3304-61-8
CAS 3304-61-8 appears in our catalog under these names: Ac-gly-onp, 98%, Ac–Gly–ONp, Ac-Gly-ONp, N-Acetyl-glycine p-nitroanilide. Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1g, 5g, 250mg, 1000mg, 500mg.
(4-nitrophenyl) 2-acetamidoacetate (CAS 3304-61-8) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: (4-nitrophenyl) 2-acetamidoacetate. InChIKey: HYJPMVGCQNBYPC-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O5 |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | (4-nitrophenyl) 2-acetamidoacetate |
| InChIKey | HYJPMVGCQNBYPC-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC(=O)OC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
AC-GLY-ONP, p-Nitrophenyl N-acetylglycinate, (4-nitrophenyl) 2-acetamidoacetate, 4-nitrophenyl acetylglycinate, N-Acetyl-glycine p-nitroanilide, N-Acetyl-glycine 4-nitrophenyl ester, 4-Nitrophenyl N-acetylglycinate, Acetyl-glycine 4-nitrophenyl ester, N-alpha-Actetyl-glycine p-nitrophenyl ester (Ac-Gly-ONp)