CAS 331763-68-9 appears in our catalog under these names: (S)–3–Amino–4–(4–fluorophenyl)butanoic acid hydrochloride, (3S)-3-Amino-4-(4-fluorophenyl)butanoic acid hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 5g, 0,5g.
(3S)-3-amino-4-(4-fluorophenyl)butanoic acid;hydrochloride (CAS 331763-68-9) is a chemical compound with the molecular formula C10H13ClFNO2 and a molecular weight of 233.67 g/mol. IUPAC name: (3S)-3-amino-4-(4-fluorophenyl)butanoic acid;hydrochloride. InChIKey: QCJJUEQWIMCTAA-FVGYRXGTSA-N.
| Molecular formula | C10H13ClFNO2 |
|---|---|
| Molecular weight | 233.67 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-fluorophenyl)butanoic acid;hydrochloride |
| InChIKey | QCJJUEQWIMCTAA-FVGYRXGTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](CC(=O)O)N)F.Cl |
Computed by PubChem (NCBI)