CAS 3337-60-8 is the registry number for 3,5-Dichloro-4-hydroxybenzamide, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
3,5-dichloro-4-hydroxybenzamide (CAS 3337-60-8) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 3,5-dichloro-4-hydroxybenzamide. InChIKey: XIDBELOIUFHQAW-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 3,5-dichloro-4-hydroxybenzamide |
| InChIKey | XIDBELOIUFHQAW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)O)Cl)C(=O)N |
Computed by PubChem (NCBI)