Products 335030-92-7
CAS 335030-92-7 is the registry number for 3-(6-Amino-2-methylpyridin-3-yl)prop-2-enoic acid, 95%. Offered by: AmBeed. Available pack sizes: 10g.
(E)-3-(6-amino-2-methyl-3-pyridinyl)prop-2-enoic acid (CAS 335030-92-7) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: (E)-3-(6-amino-2-methyl-3-pyridinyl)prop-2-enoic acid. InChIKey: KJKFNJOOMXVTJL-HWKANZROSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | (E)-3-(6-amino-2-methyl-3-pyridinyl)prop-2-enoic acid |
| InChIKey | KJKFNJOOMXVTJL-HWKANZROSA-N |
| SMILES | CC1=C(C=CC(=N1)N)/C=C/C(=O)O |
Computed by PubChem (NCBI)