CAS 33560-89-3 appears in our catalog under these names: Methyl 2-amino-3-(pyridin-4-yl)propanoate dihydrochloride, 95%, Methyl 2-amino-3-(pyridin-4-yl)propanoate dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
Methyl 2-amino-3-pyridin-4-ylpropanoate;dihydrochloride (CAS 33560-89-3) is a chemical compound with the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.12 g/mol. IUPAC name: methyl 2-amino-3-pyridin-4-ylpropanoate;dihydrochloride. InChIKey: OJOPNWQHOBRSSR-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N2O2 |
|---|---|
| Molecular weight | 253.12 g/mol |
| IUPAC name | methyl 2-amino-3-pyridin-4-ylpropanoate;dihydrochloride |
| InChIKey | OJOPNWQHOBRSSR-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)